(8E)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-6-methyl-3,4,5,6,7,8-hexahydroquinazoline-2(1H)-thione
Chemical Structure Depiction of
(8E)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-6-methyl-3,4,5,6,7,8-hexahydroquinazoline-2(1H)-thione
(8E)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-6-methyl-3,4,5,6,7,8-hexahydroquinazoline-2(1H)-thione
Compound characteristics
| Compound ID: | 5701-2280 |
| Compound Name: | (8E)-4-(4-chlorophenyl)-8-[(4-chlorophenyl)methylidene]-6-methyl-3,4,5,6,7,8-hexahydroquinazoline-2(1H)-thione |
| Molecular Weight: | 415.38 |
| Molecular Formula: | C22 H20 Cl2 N2 S |
| Smiles: | CC1C/C(=C\c2ccc(cc2)[Cl])C2=C(C1)C(c1ccc(cc1)[Cl])NC(N2)=S |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.3547 |
| logD: | 6.3547 |
| logSw: | -6.8175 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 22.8802 |
| InChI Key: | WTAKRSLFOYPHNB-UHFFFAOYSA-N |