4-(3,4-dimethoxyphenyl)-3,4,5,6-tetrahydrobenzo[h]quinazoline-2(1H)-thione
Chemical Structure Depiction of
4-(3,4-dimethoxyphenyl)-3,4,5,6-tetrahydrobenzo[h]quinazoline-2(1H)-thione
4-(3,4-dimethoxyphenyl)-3,4,5,6-tetrahydrobenzo[h]quinazoline-2(1H)-thione
Compound characteristics
| Compound ID: | 5701-2323 |
| Compound Name: | 4-(3,4-dimethoxyphenyl)-3,4,5,6-tetrahydrobenzo[h]quinazoline-2(1H)-thione |
| Molecular Weight: | 352.45 |
| Molecular Formula: | C20 H20 N2 O2 S |
| Smiles: | COc1ccc(cc1OC)C1C2CCc3ccccc3C=2NC(N1)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6638 |
| logD: | 3.6638 |
| logSw: | -3.9901 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 38.141 |
| InChI Key: | UPWWMFGRFVAGGJ-SFHVURJKSA-N |