1-(2,3-dimethylphenyl)-5-(2-phenylethyl)-1,3,5-triazinane-2-thione
Chemical Structure Depiction of
1-(2,3-dimethylphenyl)-5-(2-phenylethyl)-1,3,5-triazinane-2-thione
1-(2,3-dimethylphenyl)-5-(2-phenylethyl)-1,3,5-triazinane-2-thione
Compound characteristics
| Compound ID: | 5701-2508 |
| Compound Name: | 1-(2,3-dimethylphenyl)-5-(2-phenylethyl)-1,3,5-triazinane-2-thione |
| Molecular Weight: | 325.47 |
| Molecular Formula: | C19 H23 N3 S |
| Smiles: | Cc1cccc(c1C)N1CN(CCc2ccccc2)CNC1=S |
| Stereo: | ACHIRAL |
| logP: | 4.609 |
| logD: | 3.7677 |
| logSw: | -4.2617 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.6098 |
| InChI Key: | NTQDNUYSMZXEBG-UHFFFAOYSA-N |