3-[(1,3-benzothiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-[(1,3-benzothiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione
3-[(1,3-benzothiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 5750-1760 |
| Compound Name: | 3-[(1,3-benzothiazol-2-yl)sulfanyl]-1-(4-fluorophenyl)pyrrolidine-2,5-dione |
| Molecular Weight: | 358.41 |
| Molecular Formula: | C17 H11 F N2 O2 S2 |
| Smiles: | C1C(C(N(C1=O)c1ccc(cc1)F)=O)Sc1nc2ccccc2s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4682 |
| logD: | 3.4682 |
| logSw: | -3.661 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 38.239 |
| InChI Key: | KWWJHSGBJVZUCT-AWEZNQCLSA-N |