2-(2-fluorophenyl)-3-hydroxynaphthalene-1,4-dione
Chemical Structure Depiction of
2-(2-fluorophenyl)-3-hydroxynaphthalene-1,4-dione
2-(2-fluorophenyl)-3-hydroxynaphthalene-1,4-dione
Compound characteristics
| Compound ID: | 5750-3148 |
| Compound Name: | 2-(2-fluorophenyl)-3-hydroxynaphthalene-1,4-dione |
| Molecular Weight: | 268.24 |
| Molecular Formula: | C16 H9 F O3 |
| Smiles: | c1ccc2C(C(=C(C(c2c1)=O)c1ccccc1F)O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.584 |
| logD: | -0.0852 |
| logSw: | -2.9885 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.251 |
| InChI Key: | XBAWNIHNOMTKBG-UHFFFAOYSA-N |