4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-[2-oxo-2-(piperidin-1-yl)ethyl]phthalazin-1(2H)-one
Chemical Structure Depiction of
4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-[2-oxo-2-(piperidin-1-yl)ethyl]phthalazin-1(2H)-one
4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-[2-oxo-2-(piperidin-1-yl)ethyl]phthalazin-1(2H)-one
Compound characteristics
| Compound ID: | 5754-2983 |
| Compound Name: | 4-[4-(4-methylpiperazin-1-yl)-3-nitrophenyl]-2-[2-oxo-2-(piperidin-1-yl)ethyl]phthalazin-1(2H)-one |
| Molecular Weight: | 490.56 |
| Molecular Formula: | C26 H30 N6 O4 |
| Smiles: | CN1CCN(CC1)c1ccc(cc1[N+]([O-])=O)C1c2ccccc2C(N(CC(N2CCCCC2)=O)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2503 |
| logD: | 1.7904 |
| logSw: | -3.1079 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 83.296 |
| InChI Key: | GRPWSKQDKCQJQP-UHFFFAOYSA-N |