benzyl 6-(3-bromophenyl)-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
Chemical Structure Depiction of
benzyl 6-(3-bromophenyl)-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
benzyl 6-(3-bromophenyl)-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
Compound characteristics
| Compound ID: | 5756-2893 |
| Compound Name: | benzyl 6-(3-bromophenyl)-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| Molecular Weight: | 471.37 |
| Molecular Formula: | C22 H19 Br N2 O3 S |
| Smiles: | CC1=C(C(c2cccc(c2)[Br])N2C(=N1)SCCC2=O)C(=O)OCc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.4848 |
| logD: | 3.8854 |
| logSw: | -4.6598 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 46.035 |
| InChI Key: | UWEQBUPWLYCXED-FQEVSTJZSA-N |