5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
Chemical Structure Depiction of
5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 5762-1856 |
| Compound Name: | 5-[(2-bromo-5-ethoxy-4-methoxyphenyl)methylidene]-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| Molecular Weight: | 449.27 |
| Molecular Formula: | C20 H18 Br F N2 O4 |
| Smiles: | CCOc1cc(\C=C2/C(N(Cc3ccccc3F)C(N2)=O)=O)c(cc1OC)[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.6637 |
| logD: | 3.6635 |
| logSw: | -3.7972 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.511 |
| InChI Key: | QAOKRORXSNYYPA-UHFFFAOYSA-N |