5-{[1-(4-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylidene}-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
Chemical Structure Depiction of
5-{[1-(4-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylidene}-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
5-{[1-(4-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylidene}-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 5762-1952 |
| Compound Name: | 5-{[1-(4-fluorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl]methylidene}-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| Molecular Weight: | 407.42 |
| Molecular Formula: | C23 H19 F2 N3 O2 |
| Smiles: | Cc1cc(\C=C2/C(N(Cc3ccccc3F)C(N2)=O)=O)c(C)n1c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 4.3418 |
| logD: | 4.3418 |
| logSw: | -4.3199 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.335 |
| InChI Key: | BOHDJBIWZYWUKF-UHFFFAOYSA-N |