3-(3-chlorophenyl)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]imidazolidine-2,4-dione
Chemical Structure Depiction of
3-(3-chlorophenyl)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]imidazolidine-2,4-dione
3-(3-chlorophenyl)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 5762-2221 |
| Compound Name: | 3-(3-chlorophenyl)-5-[(4-ethoxy-3-methoxyphenyl)methylidene]imidazolidine-2,4-dione |
| Molecular Weight: | 372.81 |
| Molecular Formula: | C19 H17 Cl N2 O4 |
| Smiles: | CCOc1ccc(\C=C2/C(N(C(N2)=O)c2cccc(c2)[Cl])=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.4467 |
| logD: | 3.4322 |
| logSw: | -3.9033 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.9 |
| InChI Key: | HFTGFODFGZOPOW-UHFFFAOYSA-N |