5-({4-[(2-fluorophenyl)methoxy]phenyl}methylidene)-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
Chemical Structure Depiction of
5-({4-[(2-fluorophenyl)methoxy]phenyl}methylidene)-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
5-({4-[(2-fluorophenyl)methoxy]phenyl}methylidene)-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione
Compound characteristics
| Compound ID: | 5762-2342 |
| Compound Name: | 5-({4-[(2-fluorophenyl)methoxy]phenyl}methylidene)-3-[(2-fluorophenyl)methyl]imidazolidine-2,4-dione |
| Molecular Weight: | 420.41 |
| Molecular Formula: | C24 H18 F2 N2 O3 |
| Smiles: | C(c1ccccc1F)N1C(/C(=C\c2ccc(cc2)OCc2ccccc2F)NC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9308 |
| logD: | 4.9308 |
| logSw: | -4.8054 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.898 |
| InChI Key: | SPZNKVHMPCTPRF-UHFFFAOYSA-N |