1,5-bis(4-methoxyphenyl)-2,4-bis[(piperidin-1-yl)methyl]pentane-1,5-dione
Chemical Structure Depiction of
1,5-bis(4-methoxyphenyl)-2,4-bis[(piperidin-1-yl)methyl]pentane-1,5-dione
1,5-bis(4-methoxyphenyl)-2,4-bis[(piperidin-1-yl)methyl]pentane-1,5-dione
Compound characteristics
| Compound ID: | 5763-0262 |
| Compound Name: | 1,5-bis(4-methoxyphenyl)-2,4-bis[(piperidin-1-yl)methyl]pentane-1,5-dione |
| Molecular Weight: | 506.69 |
| Molecular Formula: | C31 H42 N2 O4 |
| Smiles: | COc1ccc(cc1)C(C(CC(CN1CCCCC1)C(c1ccc(cc1)OC)=O)CN1CCCCC1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.1769 |
| logD: | 4.8339 |
| logSw: | -4.8155 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 49.997 |
| InChI Key: | UIAMBVTUVXCGFO-UHFFFAOYSA-N |