N-(2-fluorophenyl)-2,5-dioxo-1-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-2,5-dioxo-1-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
N-(2-fluorophenyl)-2,5-dioxo-1-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | 5773-0041 |
| Compound Name: | N-(2-fluorophenyl)-2,5-dioxo-1-phenyl-1,2,5,6,7,8-hexahydroquinoline-3-carboxamide |
| Molecular Weight: | 376.39 |
| Molecular Formula: | C22 H17 F N2 O3 |
| Smiles: | C1CC2=C(C=C(C(Nc3ccccc3F)=O)C(N2c2ccccc2)=O)C(C1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7454 |
| logD: | 2.4379 |
| logSw: | -3.3221 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.973 |
| InChI Key: | IKBOYXLKHURHQD-UHFFFAOYSA-N |