3-{1-[2-(pyridin-4-yl)ethyl]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
Chemical Structure Depiction of
3-{1-[2-(pyridin-4-yl)ethyl]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
3-{1-[2-(pyridin-4-yl)ethyl]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione
Compound characteristics
| Compound ID: | 5777-3904 |
| Compound Name: | 3-{1-[2-(pyridin-4-yl)ethyl]hydrazinyl}-1H-1lambda~6~,2-benzothiazole-1,1-dione |
| Molecular Weight: | 302.35 |
| Molecular Formula: | C14 H14 N4 O2 S |
| Smiles: | C(CN(C1c2ccccc2S(N=1)(=O)=O)N)c1ccncc1 |
| Stereo: | ACHIRAL |
| logP: | 0.4845 |
| logD: | 0.4396 |
| logSw: | -1.9899 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.768 |
| InChI Key: | GGJFMCCSYXRNIJ-UHFFFAOYSA-N |