1-oxo-1-phenylpropan-2-yl 8-chloro-2-(4-methylphenyl)quinoline-4-carboxylate
Chemical Structure Depiction of
1-oxo-1-phenylpropan-2-yl 8-chloro-2-(4-methylphenyl)quinoline-4-carboxylate
1-oxo-1-phenylpropan-2-yl 8-chloro-2-(4-methylphenyl)quinoline-4-carboxylate
Compound characteristics
| Compound ID: | 5782-5959 |
| Compound Name: | 1-oxo-1-phenylpropan-2-yl 8-chloro-2-(4-methylphenyl)quinoline-4-carboxylate |
| Molecular Weight: | 429.9 |
| Molecular Formula: | C26 H20 Cl N O3 |
| Smiles: | CC(C(c1ccccc1)=O)OC(c1cc(c2ccc(C)cc2)nc2c(cccc12)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.9142 |
| logD: | 6.9129 |
| logSw: | -6.3042 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.954 |
| InChI Key: | YIKIHXUCXUNDEB-KRWDZBQOSA-N |