4-[5-(4-chloro-3-methylphenoxy)pentyl]-3,5-dimethyl-1H-pyrazole
Chemical Structure Depiction of
4-[5-(4-chloro-3-methylphenoxy)pentyl]-3,5-dimethyl-1H-pyrazole
4-[5-(4-chloro-3-methylphenoxy)pentyl]-3,5-dimethyl-1H-pyrazole
Compound characteristics
| Compound ID: | 5813-1618 |
| Compound Name: | 4-[5-(4-chloro-3-methylphenoxy)pentyl]-3,5-dimethyl-1H-pyrazole |
| Molecular Weight: | 306.83 |
| Molecular Formula: | C17 H23 Cl N2 O |
| Smiles: | Cc1cc(ccc1[Cl])OCCCCCc1c(C)n[nH]c1C |
| Stereo: | ACHIRAL |
| logP: | 5.5052 |
| logD: | 5.5047 |
| logSw: | -5.9346 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 31.2997 |
| InChI Key: | GFUYEIWIPMHUKU-UHFFFAOYSA-N |