1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 4-chlorobenzoate--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 4-chlorobenzoate--hydrogen chloride (1/1)
1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 4-chlorobenzoate--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 5821-0235 |
| Compound Name: | 1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 4-chlorobenzoate--hydrogen chloride (1/1) |
| Molecular Weight: | 346.3 |
| Molecular Formula: | C17 H24 Cl N O2 |
| Salt: | HCl |
| Smiles: | CC1CCCC(C)N1CC(C)OC(c1ccc(cc1)[Cl])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.4678 |
| logD: | 3.1296 |
| logSw: | -4.6016 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 22.842 |
| InChI Key: | GBAHPMMVENBPNR-UHFFFAOYSA-N |