2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)amino]-N'-[(4-ethoxy-2-hydroxyphenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)amino]-N'-[(4-ethoxy-2-hydroxyphenyl)methylidene]acetohydrazide
2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)amino]-N'-[(4-ethoxy-2-hydroxyphenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 5830-0015 |
| Compound Name: | 2-[(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)amino]-N'-[(4-ethoxy-2-hydroxyphenyl)methylidene]acetohydrazide |
| Molecular Weight: | 348.32 |
| Molecular Formula: | C14 H16 N6 O5 |
| Smiles: | CCOc1ccc(\C=N/NC(CNC2C(NC(NN=2)=O)=O)=O)c(c1)O |
| Stereo: | ACHIRAL |
| logP: | 0.3701 |
| logD: | -0.8086 |
| logSw: | -2.1067 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 5 |
| Polar surface area: | 131.758 |
| InChI Key: | VNKPZBHLAPJYLQ-UHFFFAOYSA-N |