3-(2-chlorophenyl)-6-[(4-ethylphenyl)methylidene][1,3]thiazolo[2,3-c][1,2,4]triazol-5(6H)-one
Chemical Structure Depiction of
3-(2-chlorophenyl)-6-[(4-ethylphenyl)methylidene][1,3]thiazolo[2,3-c][1,2,4]triazol-5(6H)-one
3-(2-chlorophenyl)-6-[(4-ethylphenyl)methylidene][1,3]thiazolo[2,3-c][1,2,4]triazol-5(6H)-one
Compound characteristics
| Compound ID: | 5865-4160 |
| Compound Name: | 3-(2-chlorophenyl)-6-[(4-ethylphenyl)methylidene][1,3]thiazolo[2,3-c][1,2,4]triazol-5(6H)-one |
| Molecular Weight: | 367.85 |
| Molecular Formula: | C19 H14 Cl N3 O S |
| Smiles: | CCc1ccc(/C=C2/C(n3c(c4ccccc4[Cl])nnc3S2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6368 |
| logD: | 4.6368 |
| logSw: | -4.8013 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.944 |
| InChI Key: | GNMGUSYYMMSKMJ-UHFFFAOYSA-N |