2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazol-4(5H)-one
Chemical Structure Depiction of
2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazol-4(5H)-one
2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazol-4(5H)-one
Compound characteristics
| Compound ID: | 5865-4197 |
| Compound Name: | 2-(4-benzylpiperazin-1-yl)-5-[(4-ethoxyphenyl)methylidene]-1,3-thiazol-4(5H)-one |
| Molecular Weight: | 407.53 |
| Molecular Formula: | C23 H25 N3 O2 S |
| Smiles: | CCOc1ccc(/C=C2/C(N=C(N3CCN(CC3)Cc3ccccc3)S2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.8827 |
| logD: | 3.7205 |
| logSw: | -3.748 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.259 |
| InChI Key: | LMLCXGUMHVTMFU-UHFFFAOYSA-N |