2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}-N-(2-fluorophenyl)acetamide
Chemical Structure Depiction of
2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}-N-(2-fluorophenyl)acetamide
2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}-N-(2-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | 5867-4112 |
| Compound Name: | 2-{[5-(4-chlorophenyl)[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl}-N-(2-fluorophenyl)acetamide |
| Molecular Weight: | 418.9 |
| Molecular Formula: | C18 H12 Cl F N4 O S2 |
| Smiles: | C(C(Nc1ccccc1F)=O)Sc1nnc2n1c(cs2)c1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.492 |
| logD: | 4.4918 |
| logSw: | -4.7958 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.237 |
| InChI Key: | UVLGMCMLYLUBQX-UHFFFAOYSA-N |