N-benzyl-1-{3-chloro-5-methoxy-4-[(thiophen-2-yl)methoxy]phenyl}methanamine--hydrogen chloride (1/1)
Chemical Structure Depiction of
N-benzyl-1-{3-chloro-5-methoxy-4-[(thiophen-2-yl)methoxy]phenyl}methanamine--hydrogen chloride (1/1)
N-benzyl-1-{3-chloro-5-methoxy-4-[(thiophen-2-yl)methoxy]phenyl}methanamine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 5868-0675 |
| Compound Name: | N-benzyl-1-{3-chloro-5-methoxy-4-[(thiophen-2-yl)methoxy]phenyl}methanamine--hydrogen chloride (1/1) |
| Molecular Weight: | 410.36 |
| Molecular Formula: | C20 H20 Cl N O2 S |
| Salt: | HCl |
| Smiles: | [H]N(Cc1ccccc1)Cc1cc(c(c(c1)[Cl])OCc1cccs1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.7109 |
| logD: | 2.5465 |
| logSw: | -4.9012 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.0539 |
| InChI Key: | XGJGFRLQVMWWQL-UHFFFAOYSA-N |