4-methoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-methoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzene-1-sulfonamide
4-methoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 5894-0070 |
| Compound Name: | 4-methoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzene-1-sulfonamide |
| Molecular Weight: | 393.46 |
| Molecular Formula: | C21 H19 N3 O3 S |
| Smiles: | Cc1cccn2cc(c3cccc(c3)NS(c3ccc(cc3)OC)(=O)=O)nc12 |
| Stereo: | ACHIRAL |
| logP: | 4.7283 |
| logD: | 4.5176 |
| logSw: | -4.4963 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.373 |
| InChI Key: | ZSPUDVOQLKKBRF-UHFFFAOYSA-N |