[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-phenylpiperazine-1-carbodithioate
Chemical Structure Depiction of
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-phenylpiperazine-1-carbodithioate
[4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-phenylpiperazine-1-carbodithioate
Compound characteristics
| Compound ID: | 5910-0184 |
| Compound Name: | [4-amino-6-(4-methylanilino)-1,3,5-triazin-2-yl]methyl 4-phenylpiperazine-1-carbodithioate |
| Molecular Weight: | 451.61 |
| Molecular Formula: | C22 H25 N7 S2 |
| Smiles: | Cc1ccc(cc1)Nc1nc(CSC(N2CCN(CC2)c2ccccc2)=S)nc(N)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.9866 |
| logD: | 4.9836 |
| logSw: | -4.6578 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.689 |
| InChI Key: | JBZQBOSJQSIXPT-UHFFFAOYSA-N |