3-(2-hydroxy-5-methylphenyl)-3-phenyl-N-[(1-phenylcyclopentyl)methyl]propanamide
Chemical Structure Depiction of
3-(2-hydroxy-5-methylphenyl)-3-phenyl-N-[(1-phenylcyclopentyl)methyl]propanamide
3-(2-hydroxy-5-methylphenyl)-3-phenyl-N-[(1-phenylcyclopentyl)methyl]propanamide
Compound characteristics
| Compound ID: | 5914-0550 |
| Compound Name: | 3-(2-hydroxy-5-methylphenyl)-3-phenyl-N-[(1-phenylcyclopentyl)methyl]propanamide |
| Molecular Weight: | 413.56 |
| Molecular Formula: | C28 H31 N O2 |
| Smiles: | Cc1ccc(c(c1)C(CC(NCC1(CCCC1)c1ccccc1)=O)c1ccccc1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1687 |
| logD: | 6.1686 |
| logSw: | -5.2094 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.001 |
| InChI Key: | SQEOYXCYSBMMKA-DEOSSOPVSA-N |