4-bromo-N-[3-(imidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide
Chemical Structure Depiction of
4-bromo-N-[3-(imidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide
4-bromo-N-[3-(imidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide
Compound characteristics
| Compound ID: | 5938-0005 |
| Compound Name: | 4-bromo-N-[3-(imidazo[2,1-b][1,3]thiazol-6-yl)phenyl]benzamide |
| Molecular Weight: | 398.28 |
| Molecular Formula: | C18 H12 Br N3 O S |
| Smiles: | c1cc(cc(c1)NC(c1ccc(cc1)[Br])=O)c1cn2ccsc2n1 |
| Stereo: | ACHIRAL |
| logP: | 4.9018 |
| logD: | 4.9015 |
| logSw: | -4.878 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.95 |
| InChI Key: | YCUGKECYRJZNEE-UHFFFAOYSA-N |