6-amino-8-{3-chloro-4-[(4-fluorophenyl)methoxy]phenyl}-2H,8H-[1,3]dioxolo[4,5-g][1]benzopyran-7-carbonitrile
Chemical Structure Depiction of
6-amino-8-{3-chloro-4-[(4-fluorophenyl)methoxy]phenyl}-2H,8H-[1,3]dioxolo[4,5-g][1]benzopyran-7-carbonitrile
6-amino-8-{3-chloro-4-[(4-fluorophenyl)methoxy]phenyl}-2H,8H-[1,3]dioxolo[4,5-g][1]benzopyran-7-carbonitrile
Compound characteristics
| Compound ID: | 5948-4262 |
| Compound Name: | 6-amino-8-{3-chloro-4-[(4-fluorophenyl)methoxy]phenyl}-2H,8H-[1,3]dioxolo[4,5-g][1]benzopyran-7-carbonitrile |
| Molecular Weight: | 450.85 |
| Molecular Formula: | C24 H16 Cl F N2 O4 |
| Smiles: | C(c1ccc(cc1)F)Oc1ccc(cc1[Cl])C1C(C#N)=C(N)Oc2cc3c(cc12)OCO3 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6046 |
| logD: | 4.6045 |
| logSw: | -4.9029 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 70.724 |
| InChI Key: | CPJHESIPDAKYBV-QHCPKHFHSA-N |