1-[5-(6-chloro-2H-[1,3]dioxolo[4,5-g]quinolin-7-yl)-3-(4-methylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one
Chemical Structure Depiction of
1-[5-(6-chloro-2H-[1,3]dioxolo[4,5-g]quinolin-7-yl)-3-(4-methylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one
1-[5-(6-chloro-2H-[1,3]dioxolo[4,5-g]quinolin-7-yl)-3-(4-methylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one
Compound characteristics
| Compound ID: | 5959-0233 |
| Compound Name: | 1-[5-(6-chloro-2H-[1,3]dioxolo[4,5-g]quinolin-7-yl)-3-(4-methylphenyl)-4,5-dihydro-1H-pyrazol-1-yl]ethan-1-one |
| Molecular Weight: | 407.86 |
| Molecular Formula: | C22 H18 Cl N3 O3 |
| Smiles: | CC(N1C(CC(c2ccc(C)cc2)=N1)c1cc2cc3c(cc2nc1[Cl])OCO3)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9502 |
| logD: | 4.9502 |
| logSw: | -5.0288 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.938 |
| InChI Key: | UCCKEXFSEVWSDE-IBGZPJMESA-N |