4-bromo-5-(morpholin-4-yl)-2-phenylpyridazin-3(2H)-one
Chemical Structure Depiction of
4-bromo-5-(morpholin-4-yl)-2-phenylpyridazin-3(2H)-one
4-bromo-5-(morpholin-4-yl)-2-phenylpyridazin-3(2H)-one
Compound characteristics
| Compound ID: | 5976-1425 |
| Compound Name: | 4-bromo-5-(morpholin-4-yl)-2-phenylpyridazin-3(2H)-one |
| Molecular Weight: | 336.19 |
| Molecular Formula: | C14 H14 Br N3 O2 |
| Smiles: | C1COCCN1C1C=NN(C(C=1[Br])=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 1.7571 |
| logD: | 1.7571 |
| logSw: | -2.2639 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.896 |
| InChI Key: | HHIGEMSQAJOBTL-UHFFFAOYSA-N |