3-{[4-(4-chlorobenzene-1-sulfonyl)piperazin-1-yl]methyl}-9-ethyl-9H-carbazole--oxalic acid (1/1)
Chemical Structure Depiction of
3-{[4-(4-chlorobenzene-1-sulfonyl)piperazin-1-yl]methyl}-9-ethyl-9H-carbazole--oxalic acid (1/1)
3-{[4-(4-chlorobenzene-1-sulfonyl)piperazin-1-yl]methyl}-9-ethyl-9H-carbazole--oxalic acid (1/1)
Compound characteristics
| Compound ID: | 5981-0684 |
| Compound Name: | 3-{[4-(4-chlorobenzene-1-sulfonyl)piperazin-1-yl]methyl}-9-ethyl-9H-carbazole--oxalic acid (1/1) |
| Molecular Weight: | 558.05 |
| Molecular Formula: | C25 H26 Cl N3 O2 S |
| Salt: | HOOCCOOH |
| Smiles: | CCn1c2ccccc2c2cc(CN3CCN(CC3)S(c3ccc(cc3)[Cl])(=O)=O)ccc12 |
| Stereo: | ACHIRAL |
| logP: | 5.4648 |
| logD: | 5.4624 |
| logSw: | -6.0499 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 36.19 |
| InChI Key: | RZFWPIITEAXLDB-UHFFFAOYSA-N |