propan-2-yl 4-(4-ethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 4-(4-ethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
propan-2-yl 4-(4-ethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 5991-0065 |
| Compound Name: | propan-2-yl 4-(4-ethoxyphenyl)-7-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 475.59 |
| Molecular Formula: | C29 H33 N O5 |
| Smiles: | CCOc1ccc(cc1)C1C(=C(C)NC2CC(CC(C1=2)=O)c1ccc(cc1)OC)C(=O)OC(C)C |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.8182 |
| logD: | 1.3379 |
| logSw: | -5.5768 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.75 |
| InChI Key: | VQFUQRCUHGDMSV-UHFFFAOYSA-N |