cyclopentyl 2-methyl-4-(naphthalen-1-yl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
cyclopentyl 2-methyl-4-(naphthalen-1-yl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
cyclopentyl 2-methyl-4-(naphthalen-1-yl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 5991-0169 |
| Compound Name: | cyclopentyl 2-methyl-4-(naphthalen-1-yl)-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 401.5 |
| Molecular Formula: | C26 H27 N O3 |
| Smiles: | CC1=C(C(C2=C(CCCC2=O)N1)c1cccc2ccccc12)C(=O)OC1CCCC1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.289 |
| logD: | 1.4341 |
| logSw: | -6.2846 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.1 |
| InChI Key: | RRVWNKTZLHSQMO-DEOSSOPVSA-N |