cyclopentyl 7-(3-methoxyphenyl)-2-methyl-5-oxo-4-(thiophen-2-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
cyclopentyl 7-(3-methoxyphenyl)-2-methyl-5-oxo-4-(thiophen-2-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
cyclopentyl 7-(3-methoxyphenyl)-2-methyl-5-oxo-4-(thiophen-2-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 5991-0568 |
| Compound Name: | cyclopentyl 7-(3-methoxyphenyl)-2-methyl-5-oxo-4-(thiophen-2-yl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 463.6 |
| Molecular Formula: | C27 H29 N O4 S |
| Smiles: | CC1=C(C(C2=C(CC(CC2=O)c2cccc(c2)OC)N1)c1cccs1)C(=O)OC1CCCC1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.3501 |
| logD: | 0.7173 |
| logSw: | -5.3753 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.662 |
| InChI Key: | GFCAWCOILOJCFU-UHFFFAOYSA-N |