3-(2-chlorophenyl)-5-methyl-N-[2-(methylsulfanyl)phenyl]-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
3-(2-chlorophenyl)-5-methyl-N-[2-(methylsulfanyl)phenyl]-1,2-oxazole-4-carboxamide
3-(2-chlorophenyl)-5-methyl-N-[2-(methylsulfanyl)phenyl]-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | 6013-1763 |
| Compound Name: | 3-(2-chlorophenyl)-5-methyl-N-[2-(methylsulfanyl)phenyl]-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 358.84 |
| Molecular Formula: | C18 H15 Cl N2 O2 S |
| Smiles: | Cc1c(C(Nc2ccccc2SC)=O)c(c2ccccc2[Cl])no1 |
| Stereo: | ACHIRAL |
| logP: | 4.1061 |
| logD: | 4.1059 |
| logSw: | -4.6672 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.592 |
| InChI Key: | WYUVXJAJYMHNKI-UHFFFAOYSA-N |