N'-(4-bromobenzene-1-sulfonyl)-N-tert-butylbenzenecarboximidamide
Chemical Structure Depiction of
N'-(4-bromobenzene-1-sulfonyl)-N-tert-butylbenzenecarboximidamide
N'-(4-bromobenzene-1-sulfonyl)-N-tert-butylbenzenecarboximidamide
Compound characteristics
| Compound ID: | 6024-0199 |
| Compound Name: | N'-(4-bromobenzene-1-sulfonyl)-N-tert-butylbenzenecarboximidamide |
| Molecular Weight: | 395.32 |
| Molecular Formula: | C17 H19 Br N2 O2 S |
| Smiles: | CC(C)(C)NC(\c1ccccc1)=N/S(c1ccc(cc1)[Br])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6665 |
| logD: | 4.6665 |
| logSw: | -4.403 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.106 |
| InChI Key: | MJONYABOSUZTIA-UHFFFAOYSA-N |