2-(3-chloro-1-benzothiophen-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole
Chemical Structure Depiction of
2-(3-chloro-1-benzothiophen-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole
2-(3-chloro-1-benzothiophen-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole
Compound characteristics
| Compound ID: | 6048-0068 |
| Compound Name: | 2-(3-chloro-1-benzothiophen-2-yl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
| Molecular Weight: | 342.8 |
| Molecular Formula: | C17 H11 Cl N2 O2 S |
| Smiles: | COc1ccc(cc1)c1nnc(c2c(c3ccccc3s2)[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 4.9834 |
| logD: | 4.9834 |
| logSw: | -5.2344 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.773 |
| InChI Key: | MWVZCBSEIZIMGM-UHFFFAOYSA-N |