propan-2-yl 4,5-dimethyl-2-[(1-oxo-1H-2-benzopyran-3-carbonyl)amino]thiophene-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 4,5-dimethyl-2-[(1-oxo-1H-2-benzopyran-3-carbonyl)amino]thiophene-3-carboxylate
propan-2-yl 4,5-dimethyl-2-[(1-oxo-1H-2-benzopyran-3-carbonyl)amino]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 6049-1305 |
| Compound Name: | propan-2-yl 4,5-dimethyl-2-[(1-oxo-1H-2-benzopyran-3-carbonyl)amino]thiophene-3-carboxylate |
| Molecular Weight: | 385.44 |
| Molecular Formula: | C20 H19 N O5 S |
| Smiles: | CC(C)OC(c1c(C)c(C)sc1NC(C1=Cc2ccccc2C(=O)O1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1936 |
| logD: | 0.1855 |
| logSw: | -4.5045 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.964 |
| InChI Key: | HISHGPWDRPAPKK-UHFFFAOYSA-N |