N,N'-(2,2-dimethylpropane-1,3-diyl)di(9H-xanthene-9-carboxamide)
Chemical Structure Depiction of
N,N'-(2,2-dimethylpropane-1,3-diyl)di(9H-xanthene-9-carboxamide)
N,N'-(2,2-dimethylpropane-1,3-diyl)di(9H-xanthene-9-carboxamide)
Compound characteristics
| Compound ID: | 6049-1648 |
| Compound Name: | N,N'-(2,2-dimethylpropane-1,3-diyl)di(9H-xanthene-9-carboxamide) |
| Molecular Weight: | 518.61 |
| Molecular Formula: | C33 H30 N2 O4 |
| Smiles: | CC(C)(CNC(C1c2ccccc2Oc2ccccc12)=O)CNC(C1c2ccccc2Oc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1748 |
| logD: | -0.5494 |
| logSw: | -5.2028 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.964 |
| InChI Key: | NYOXEPKZUSDFQO-UHFFFAOYSA-N |