[2-(5-methylfuran-2-yl)quinolin-4-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Chemical Structure Depiction of
[2-(5-methylfuran-2-yl)quinolin-4-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
[2-(5-methylfuran-2-yl)quinolin-4-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | 6049-1705 |
| Compound Name: | [2-(5-methylfuran-2-yl)quinolin-4-yl]{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}methanone |
| Molecular Weight: | 465.47 |
| Molecular Formula: | C26 H22 F3 N3 O2 |
| Smiles: | Cc1ccc(c2cc(C(N3CCN(CC3)c3cccc(c3)C(F)(F)F)=O)c3ccccc3n2)o1 |
| Stereo: | ACHIRAL |
| logP: | 5.6993 |
| logD: | 5.6992 |
| logSw: | -5.8827 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 36.299 |
| InChI Key: | AVNAVWCVFUTDAT-UHFFFAOYSA-N |