6-bromo-2-(2-ethoxyphenyl)quinoline-4-carboxylic acid
Chemical Structure Depiction of
6-bromo-2-(2-ethoxyphenyl)quinoline-4-carboxylic acid
6-bromo-2-(2-ethoxyphenyl)quinoline-4-carboxylic acid
Compound characteristics
| Compound ID: | 6049-2167 |
| Compound Name: | 6-bromo-2-(2-ethoxyphenyl)quinoline-4-carboxylic acid |
| Molecular Weight: | 372.22 |
| Molecular Formula: | C18 H14 Br N O3 |
| Smiles: | CCOc1ccccc1c1cc(C(O)=O)c2cc(ccc2n1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.1948 |
| logD: | 0.3124 |
| logSw: | -4.8956 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.916 |
| InChI Key: | FCTLWADVTIXXBV-UHFFFAOYSA-N |