methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiophene-3-carboxylate
Chemical Structure Depiction of
methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiophene-3-carboxylate
methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | 6049-2774 |
| Compound Name: | methyl 5-(dimethylcarbamoyl)-4-methyl-2-[(5-methyl-3-phenyl-1,2-oxazole-4-carbonyl)amino]thiophene-3-carboxylate |
| Molecular Weight: | 427.48 |
| Molecular Formula: | C21 H21 N3 O5 S |
| Smiles: | Cc1c(C(=O)OC)c(NC(c2c(c3ccccc3)noc2C)=O)sc1C(N(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1325 |
| logD: | -0.1206 |
| logSw: | -2.7921 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.259 |
| InChI Key: | QEOZDHAORSEUEL-UHFFFAOYSA-N |