6-bromo-N-[(1,3-dimethyl-1H-pyrazol-4-yl)methyl]-2-(4-methylphenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
6-bromo-N-[(1,3-dimethyl-1H-pyrazol-4-yl)methyl]-2-(4-methylphenyl)quinoline-4-carboxamide
6-bromo-N-[(1,3-dimethyl-1H-pyrazol-4-yl)methyl]-2-(4-methylphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | 6049-2818 |
| Compound Name: | 6-bromo-N-[(1,3-dimethyl-1H-pyrazol-4-yl)methyl]-2-(4-methylphenyl)quinoline-4-carboxamide |
| Molecular Weight: | 449.35 |
| Molecular Formula: | C23 H21 Br N4 O |
| Smiles: | Cc1ccc(cc1)c1cc(C(NCc2cn(C)nc2C)=O)c2cc(ccc2n1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 5.337 |
| logD: | 5.3365 |
| logSw: | -5.3 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.873 |
| InChI Key: | FBEKYLPJTBCJFU-UHFFFAOYSA-N |