8-tert-butyl-4-(4-fluorophenyl)-1-thia-4-azaspiro[4.5]decan-3-one
Chemical Structure Depiction of
8-tert-butyl-4-(4-fluorophenyl)-1-thia-4-azaspiro[4.5]decan-3-one
8-tert-butyl-4-(4-fluorophenyl)-1-thia-4-azaspiro[4.5]decan-3-one
Compound characteristics
| Compound ID: | 6063-1373 |
| Compound Name: | 8-tert-butyl-4-(4-fluorophenyl)-1-thia-4-azaspiro[4.5]decan-3-one |
| Molecular Weight: | 321.46 |
| Molecular Formula: | C18 H24 F N O S |
| Smiles: | CC(C)(C)C1CCC2(CC1)N(C(CS2)=O)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 4.7672 |
| logD: | 4.7672 |
| logSw: | -4.4734 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 16.1116 |
| InChI Key: | NKUWLNDOSNBZEV-UHFFFAOYSA-N |