1-(4-methylbenzene-1-sulfonyl)-4-{2-[4-(propan-2-yl)phenoxy]ethyl}piperazine
Chemical Structure Depiction of
1-(4-methylbenzene-1-sulfonyl)-4-{2-[4-(propan-2-yl)phenoxy]ethyl}piperazine
1-(4-methylbenzene-1-sulfonyl)-4-{2-[4-(propan-2-yl)phenoxy]ethyl}piperazine
Compound characteristics
| Compound ID: | 6074-2693 |
| Compound Name: | 1-(4-methylbenzene-1-sulfonyl)-4-{2-[4-(propan-2-yl)phenoxy]ethyl}piperazine |
| Molecular Weight: | 402.55 |
| Molecular Formula: | C22 H30 N2 O3 S |
| Smiles: | CC(C)c1ccc(cc1)OCCN1CCN(CC1)S(c1ccc(C)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7319 |
| logD: | 4.7288 |
| logSw: | -4.3316 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 42.886 |
| InChI Key: | BIWRJNZSKRUVAD-UHFFFAOYSA-N |