3-amino-N-(3-fluoro-4-methylphenyl)-6-(4-fluorophenyl)thieno[2,3-b]pyridine-2-carboxamide
Chemical Structure Depiction of
3-amino-N-(3-fluoro-4-methylphenyl)-6-(4-fluorophenyl)thieno[2,3-b]pyridine-2-carboxamide
3-amino-N-(3-fluoro-4-methylphenyl)-6-(4-fluorophenyl)thieno[2,3-b]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | 6114-0095 |
| Compound Name: | 3-amino-N-(3-fluoro-4-methylphenyl)-6-(4-fluorophenyl)thieno[2,3-b]pyridine-2-carboxamide |
| Molecular Weight: | 395.43 |
| Molecular Formula: | C21 H15 F2 N3 O S |
| Smiles: | Cc1ccc(cc1F)NC(c1c(c2ccc(c3ccc(cc3)F)nc2s1)N)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7225 |
| logD: | 5.7218 |
| logSw: | -5.5842 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 52.165 |
| InChI Key: | FYWTZCDSXKFMFO-UHFFFAOYSA-N |