[4-(1,8-dioxo-2,3,4,5,6,7,8,9-octahydro-1H-xanthen-9-yl)-2-ethoxyphenoxy]acetic acid
Chemical Structure Depiction of
[4-(1,8-dioxo-2,3,4,5,6,7,8,9-octahydro-1H-xanthen-9-yl)-2-ethoxyphenoxy]acetic acid
[4-(1,8-dioxo-2,3,4,5,6,7,8,9-octahydro-1H-xanthen-9-yl)-2-ethoxyphenoxy]acetic acid
Compound characteristics
| Compound ID: | 6134-4309 |
| Compound Name: | [4-(1,8-dioxo-2,3,4,5,6,7,8,9-octahydro-1H-xanthen-9-yl)-2-ethoxyphenoxy]acetic acid |
| Molecular Weight: | 412.44 |
| Molecular Formula: | C23 H24 O7 |
| Smiles: | CCOc1cc(ccc1OCC(O)=O)C1C2=C(CCCC2=O)OC2CCCC(C1=2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1002 |
| logD: | -2.1368 |
| logSw: | -2.7164 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.577 |
| InChI Key: | OARDAWCTZZTODJ-UHFFFAOYSA-N |