4-[(9,10-dioxo-9,10-dihydroanthracene-2-sulfonyl)amino]benzoic acid
Chemical Structure Depiction of
4-[(9,10-dioxo-9,10-dihydroanthracene-2-sulfonyl)amino]benzoic acid
4-[(9,10-dioxo-9,10-dihydroanthracene-2-sulfonyl)amino]benzoic acid
Compound characteristics
| Compound ID: | 6144-0252 |
| Compound Name: | 4-[(9,10-dioxo-9,10-dihydroanthracene-2-sulfonyl)amino]benzoic acid |
| Molecular Weight: | 407.4 |
| Molecular Formula: | C21 H13 N O6 S |
| Smiles: | c1ccc2C(c3cc(ccc3C(c2c1)=O)S(Nc1ccc(cc1)C(O)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1663 |
| logD: | 1.771 |
| logSw: | -4.2597 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 95.238 |
| InChI Key: | BTMWPCZAKUWSNT-UHFFFAOYSA-N |