4-chloro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzene-1-sulfonamide
Chemical Structure Depiction of
4-chloro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzene-1-sulfonamide
4-chloro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzene-1-sulfonamide
Compound characteristics
| Compound ID: | 6165-0315 |
| Compound Name: | 4-chloro-N-[2,4,6-trioxo-1-phenyl-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-pyrrolo[2,3-d]pyrimidin-5-yl]benzene-1-sulfonamide |
| Molecular Weight: | 500.84 |
| Molecular Formula: | C19 H12 Cl F3 N4 O5 S |
| Smiles: | c1ccc(cc1)N1C2=C(C(NC1=O)=O)C(C(N2)=O)(C(F)(F)F)NS(c1ccc(cc1)[Cl])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4495 |
| logD: | -1.71 |
| logSw: | -3.3081 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 107.16 |
| InChI Key: | ZOWHADDFZZEYNJ-SFHVURJKSA-N |