4-(7,7-dimethyl-9,11-dioxo-6,7,8,9,10,11-hexahydro-5H-indeno[1,2-b]quinolin-10-yl)phenyl propanoate
Chemical Structure Depiction of
4-(7,7-dimethyl-9,11-dioxo-6,7,8,9,10,11-hexahydro-5H-indeno[1,2-b]quinolin-10-yl)phenyl propanoate
4-(7,7-dimethyl-9,11-dioxo-6,7,8,9,10,11-hexahydro-5H-indeno[1,2-b]quinolin-10-yl)phenyl propanoate
Compound characteristics
| Compound ID: | 6186-3059 |
| Compound Name: | 4-(7,7-dimethyl-9,11-dioxo-6,7,8,9,10,11-hexahydro-5H-indeno[1,2-b]quinolin-10-yl)phenyl propanoate |
| Molecular Weight: | 427.5 |
| Molecular Formula: | C27 H25 N O4 |
| Smiles: | CCC(=O)Oc1ccc(cc1)C1C2=C(CC(C)(C)CC2=O)NC2=C1C(c1ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3895 |
| logD: | 0.2159 |
| logSw: | -4.5937 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.694 |
| InChI Key: | MFCVBKLQWCIXSY-QFIPXVFZSA-N |