prop-2-en-1-yl 6-[4-(acetyloxy)-3-ethoxyphenyl]-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
Chemical Structure Depiction of
prop-2-en-1-yl 6-[4-(acetyloxy)-3-ethoxyphenyl]-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
prop-2-en-1-yl 6-[4-(acetyloxy)-3-ethoxyphenyl]-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate
Compound characteristics
| Compound ID: | 6187-0012 |
| Compound Name: | prop-2-en-1-yl 6-[4-(acetyloxy)-3-ethoxyphenyl]-8-methyl-4-oxo-3,4-dihydro-2H,6H-pyrimido[2,1-b][1,3]thiazine-7-carboxylate |
| Molecular Weight: | 444.51 |
| Molecular Formula: | C22 H24 N2 O6 S |
| Smiles: | CCOc1cc(ccc1OC(C)=O)C1C(=C(C)N=C2N1C(CCS2)=O)C(=O)OCC=C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.2908 |
| logD: | 1.6915 |
| logSw: | -2.7752 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 74.273 |
| InChI Key: | KGZYLSKXIBEAID-HXUWFJFHSA-N |